C22H21BrINO2 — CID 126122095
N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]aniline (PubChem CID 126122095) has the molecular formula C22H21BrINO2 and a molecular weight of 538.22 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]aniline.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]aniline |
|---|---|
| PubChem CID | 126122095 |
| Molecular Formula | C22H21BrINO2 |
| Molecular Weight | 538.22 g/mol |
| Exact Mass | 536.98 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]aniline |
| SMILES | CCOc1cc(CNc2ccccc2)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrINO2/c1-2-26-21-13-17(14-25-19-6-4-3-5-7-19)12-20(24)22(21)27-15-16-8-10-18(23)11-9-16/h3-13,25H,2,14-15H2,1H3 |
| InChIKey | KKPCJYHBMOHQOP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.22 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|