C22H21IN2O4 — CID 126119182
N-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline (PubChem CID 126119182) has the molecular formula C22H21IN2O4 and a molecular weight of 504.32 g/mol. Its IUPAC name is N-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline.
| Compound Name | N-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 126119182 |
| Molecular Formula | C22H21IN2O4 |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | N-[[3-ethoxy-5-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]aniline |
| SMILES | CCOc1cc(CNc2ccccc2)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21IN2O4/c1-2-28-21-13-17(14-24-18-6-4-3-5-7-18)12-20(23)22(21)29-15-16-8-10-19(11-9-16)25(26)27/h3-13,24H,2,14-15H2,1H3 |
| InChIKey | DMAWVQDIAHNFMH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|