C22H20Br2N2O4 — CID 126121029
N-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline (PubChem CID 126121029) has the molecular formula C22H20Br2N2O4 and a molecular weight of 536.22 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 126121029 |
| Molecular Formula | C22H20Br2N2O4 |
| Molecular Weight | 536.22 g/mol |
| Exact Mass | 533.98 |
| IUPAC Name | N-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2cc(Br)c(OCc3ccc([N+](=O)[O-])cc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C22H20Br2N2O4/c1-2-29-19-9-5-17(6-10-19)25-13-16-11-20(23)22(21(24)12-16)30-14-15-3-7-18(8-4-15)26(27)28/h3-12,25H,2,13-14H2,1H3 |
| InChIKey | IVKIRLBNYSNGMA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.22 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|