C23H23BrFNO3 — CID 126119393
N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethoxyaniline (PubChem CID 126119393) has the molecular formula C23H23BrFNO3 and a molecular weight of 460.34 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 126119393 |
| Molecular Formula | C23H23BrFNO3 |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2cc(Br)c(OCc3ccc(F)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H23BrFNO3/c1-3-28-20-10-8-19(9-11-20)26-14-17-12-21(24)23(22(13-17)27-2)29-15-16-4-6-18(25)7-5-16/h4-13,26H,3,14-15H2,1-2H3 |
| InChIKey | GJZAXIAAARNWEY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|