C24H26INO3 — CID 126116262
4-ethoxy-N-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline (PubChem CID 126116262) has the molecular formula C24H26INO3 and a molecular weight of 503.38 g/mol. Its IUPAC name is 4-ethoxy-N-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline.
| Compound Name | 4-ethoxy-N-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 126116262 |
| Molecular Formula | C24H26INO3 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 4-ethoxy-N-[[3-iodo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline |
| SMILES | CCOc1ccc(NCc2cc(I)c(OCc3ccc(C)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H26INO3/c1-4-28-21-11-9-20(10-12-21)26-15-19-13-22(25)24(23(14-19)27-3)29-16-18-7-5-17(2)6-8-18/h5-14,26H,4,15-16H2,1-3H3 |
| InChIKey | OFIIULJDOULLJZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|