C24H25FINO3 — CID 126128745
4-ethoxy-N-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methyl]aniline (PubChem CID 126128745) has the molecular formula C24H25FINO3 and a molecular weight of 521.37 g/mol. Its IUPAC name is 4-ethoxy-N-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methyl]aniline.
| Compound Name | 4-ethoxy-N-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methyl]aniline |
|---|---|
| PubChem CID | 126128745 |
| Molecular Formula | C24H25FINO3 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 4-ethoxy-N-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methyl]aniline |
| SMILES | CCOc1ccc(NCc2cc(I)c(OCc3ccc(F)cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C24H25FINO3/c1-3-28-21-11-9-20(10-12-21)27-15-18-13-22(26)24(23(14-18)29-4-2)30-16-17-5-7-19(25)8-6-17/h5-14,27H,3-4,15-16H2,1-2H3 |
| InChIKey | YNJDKEBAENYKEN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|