C18H21FINO2 — CID 126207922
N-[(3-ethoxy-5-iodo-4-propoxyphenyl)methyl]-4-fluoroaniline (PubChem CID 126207922) has the molecular formula C18H21FINO2 and a molecular weight of 429.27 g/mol. Its IUPAC name is N-[(3-ethoxy-5-iodo-4-propoxyphenyl)methyl]-4-fluoroaniline.
| Compound Name | N-[(3-ethoxy-5-iodo-4-propoxyphenyl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 126207922 |
| Molecular Formula | C18H21FINO2 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-[(3-ethoxy-5-iodo-4-propoxyphenyl)methyl]-4-fluoroaniline |
| SMILES | CCCOc1c(I)cc(CNc2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C18H21FINO2/c1-3-9-23-18-16(20)10-13(11-17(18)22-4-2)12-21-15-7-5-14(19)6-8-15/h5-8,10-11,21H,3-4,9,12H2,1-2H3 |
| InChIKey | XIPXVNREHZKLND-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|