C23H23FINO3 — CID 126128629
N-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methyl]-4-methoxyaniline (PubChem CID 126128629) has the molecular formula C23H23FINO3 and a molecular weight of 507.34 g/mol. Its IUPAC name is N-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methyl]-4-methoxyaniline.
| Compound Name | N-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 126128629 |
| Molecular Formula | C23H23FINO3 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | N-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methyl]-4-methoxyaniline |
| SMILES | CCOc1cc(CNc2ccc(OC)cc2)cc(I)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C23H23FINO3/c1-3-28-22-13-17(14-26-19-7-9-20(27-2)10-8-19)12-21(25)23(22)29-15-16-5-4-6-18(24)11-16/h4-13,26H,3,14-15H2,1-2H3 |
| InChIKey | XUPLCYXGDFVQTH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|