C23H22BrClFNO2 — CID 126121149
N-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline (PubChem CID 126121149) has the molecular formula C23H22BrClFNO2 and a molecular weight of 478.79 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline |
|---|---|
| PubChem CID | 126121149 |
| Molecular Formula | C23H22BrClFNO2 |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline |
| SMILES | CCOc1cc(CNc2ccc(C)c(Cl)c2)cc(Br)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C23H22BrClFNO2/c1-3-28-22-11-17(13-27-19-8-7-15(2)21(25)12-19)10-20(24)23(22)29-14-16-5-4-6-18(26)9-16/h4-12,27H,3,13-14H2,1-2H3 |
| InChIKey | QLSHGGSKNZQKCY-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |