C21H18BrClFNO — CID 126119144
N-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline (PubChem CID 126119144) has the molecular formula C21H18BrClFNO and a molecular weight of 434.74 g/mol. Its IUPAC name is N-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline.
| Compound Name | N-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline |
|---|---|
| PubChem CID | 126119144 |
| Molecular Formula | C21H18BrClFNO |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | N-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-chloro-4-methylaniline |
| SMILES | Cc1ccc(NCc2cc(Br)ccc2OCc2cccc(F)c2)cc1Cl |
| InChI | InChI=1S/C21H18BrClFNO/c1-14-5-7-19(11-20(14)23)25-12-16-10-17(22)6-8-21(16)26-13-15-3-2-4-18(24)9-15/h2-11,25H,12-13H2,1H3 |
| InChIKey | DFUGJDMOLNNNNG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |