C22H21ClFNO — CID 126126042
N-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-4-ethylaniline (PubChem CID 126126042) has the molecular formula C22H21ClFNO and a molecular weight of 369.87 g/mol. Its IUPAC name is N-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-4-ethylaniline.
| Compound Name | N-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-4-ethylaniline |
|---|---|
| PubChem CID | 126126042 |
| Molecular Formula | C22H21ClFNO |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methyl]-4-ethylaniline |
| SMILES | CCc1ccc(NCc2ccc(OCc3cccc(F)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H21ClFNO/c1-2-16-6-9-20(10-7-16)25-14-17-8-11-22(21(23)13-17)26-15-18-4-3-5-19(24)12-18/h3-13,25H,2,14-15H2,1H3 |
| InChIKey | XRYVDDHQNQZWSU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |