C21H19ClFNO2 — CID 3348285
4-chloro-N-[[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]aniline (PubChem CID 3348285) has the molecular formula C21H19ClFNO2 and a molecular weight of 371.84 g/mol. Its IUPAC name is 4-chloro-N-[[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]aniline.
| Compound Name | 4-chloro-N-[[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]aniline |
|---|---|
| PubChem CID | 3348285 |
| Molecular Formula | C21H19ClFNO2 |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-chloro-N-[[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]aniline |
| SMILES | COc1cc(CNc2ccc(Cl)cc2)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C21H19ClFNO2/c1-25-21-12-15(13-24-19-8-6-17(22)7-9-19)5-10-20(21)26-14-16-3-2-4-18(23)11-16/h2-12,24H,13-14H2,1H3 |
| InChIKey | XOEIAJPJFASTOM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |