C22H21Cl2NO3 — CID 23792149
N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline (PubChem CID 23792149) has the molecular formula C22H21Cl2NO3 and a molecular weight of 418.32 g/mol. Its IUPAC name is N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline.
| Compound Name | N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 23792149 |
| Molecular Formula | C22H21Cl2NO3 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCc2ccc(OCc3c(Cl)cccc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H21Cl2NO3/c1-26-17-9-7-16(8-10-17)25-13-15-6-11-21(22(12-15)27-2)28-14-18-19(23)4-3-5-20(18)24/h3-12,25H,13-14H2,1-2H3 |
| InChIKey | PSODQWZZKGQGCC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|