C20H26Cl2N2O2 — CID 17215642
N'-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215642) has the molecular formula C20H26Cl2N2O2 and a molecular weight of 397.35 g/mol. Its IUPAC name is N'-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215642 |
| Molecular Formula | C20H26Cl2N2O2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N'-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1ccc(OCc2c(Cl)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C20H26Cl2N2O2/c1-3-23-10-5-11-24-13-15-8-9-19(20(12-15)25-2)26-14-16-17(21)6-4-7-18(16)22/h4,6-9,12,23-24H,3,5,10-11,13-14H2,1-2H3 |
| InChIKey | GEBNFPINVASJKZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|