C21H30N2O2 — CID 17215636
N-ethyl-N'-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propane-1,3-diamine (PubChem CID 17215636) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-ethyl-N'-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17215636 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-ethyl-N'-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propane-1,3-diamine |
| SMILES | CCNCCCNCc1ccc(OCc2cccc(C)c2)c(OC)c1 |
| InChI | InChI=1S/C21H30N2O2/c1-4-22-11-6-12-23-15-18-9-10-20(21(14-18)24-3)25-16-19-8-5-7-17(2)13-19/h5,7-10,13-14,22-23H,4,6,11-12,15-16H2,1-3H3 |
| InChIKey | UYLWLGHOXFYARL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|