C17H22ClNO2 — CID 17293869
1-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-N-methylmethanamine;hydrochloride (PubChem CID 17293869) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 1-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 17293869 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1ccc(OCc2cccc(C)c2)c(OC)c1.Cl |
| InChI | InChI=1S/C17H21NO2.ClH/c1-13-5-4-6-15(9-13)12-20-16-8-7-14(11-18-2)10-17(16)19-3;/h4-10,18H,11-12H2,1-3H3;1H |
| InChIKey | OKRAFBCDXZRUNF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |