C18H23NO3 — CID 92925113
2-[[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylamino]ethanol (PubChem CID 92925113) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylamino]ethanol.
| Compound Name | 2-[[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 92925113 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[[4-methoxy-3-[(3-methylphenyl)methoxy]phenyl]methylamino]ethanol |
| SMILES | COc1ccc(CNCCO)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C18H23NO3/c1-14-4-3-5-16(10-14)13-22-18-11-15(12-19-8-9-20)6-7-17(18)21-2/h3-7,10-11,19-20H,8-9,12-13H2,1-2H3 |
| InChIKey | SBBMSWMNZULTOW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|