C25H28Cl3NO4 — CID 17293841
N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (PubChem CID 17293841) has the molecular formula C25H28Cl3NO4 and a molecular weight of 512.86 g/mol. Its IUPAC name is N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17293841 |
| Molecular Formula | C25H28Cl3NO4 |
| Molecular Weight | 512.86 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2ccc(OCc3c(Cl)cccc3Cl)c(OC)c2)cc1OC.Cl |
| InChI | InChI=1S/C25H27Cl2NO4.ClH/c1-29-22-9-7-17(13-24(22)30-2)11-12-28-15-18-8-10-23(25(14-18)31-3)32-16-19-20(26)5-4-6-21(19)27;/h4-10,13-14,28H,11-12,15-16H2,1-3H3;1H |
| InChIKey | YRRVGQLZJLUPGV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.86 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|