C23H22Cl3NO2 — CID 17208609
2-(4-chlorophenyl)-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine (PubChem CID 17208609) has the molecular formula C23H22Cl3NO2 and a molecular weight of 450.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 17208609 |
| Molecular Formula | C23H22Cl3NO2 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine |
| SMILES | COc1cc(CNCCc2ccc(Cl)cc2)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H22Cl3NO2/c1-28-23-13-17(14-27-12-11-16-5-8-18(24)9-6-16)7-10-22(23)29-15-19-20(25)3-2-4-21(19)26/h2-10,13,27H,11-12,14-15H2,1H3 |
| InChIKey | AVFHWSYHVXATGD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|