C20H23Cl2N5O2S — CID 4725205
N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 4725205) has the molecular formula C20H23Cl2N5O2S and a molecular weight of 468.41 g/mol. Its IUPAC name is N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 4725205 |
| Molecular Formula | C20H23Cl2N5O2S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-[[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | COc1cc(CNCCCSc2nnnn2C)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H23Cl2N5O2S/c1-27-20(24-25-26-27)30-10-4-9-23-12-14-7-8-18(19(11-14)28-2)29-13-15-16(21)5-3-6-17(15)22/h3,5-8,11,23H,4,9-10,12-13H2,1-2H3 |
| InChIKey | FZXPMQLYBVNQGF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|