C20H24ClN5O2S — CID 66529114
N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 66529114) has the molecular formula C20H24ClN5O2S and a molecular weight of 433.97 g/mol. Its IUPAC name is N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 66529114 |
| Molecular Formula | C20H24ClN5O2S |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | COc1cc(CNCCCSc2nnnn2C)c(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H24ClN5O2S/c1-26-20(23-24-25-26)29-10-6-9-22-13-16-11-18(27-2)19(12-17(16)21)28-14-15-7-4-3-5-8-15/h3-5,7-8,11-12,22H,6,9-10,13-14H2,1-2H3 |
| InChIKey | NBOUGCUNICCDMN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|