C14H20ClN5O2S — CID 66530317
N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 66530317) has the molecular formula C14H20ClN5O2S and a molecular weight of 357.87 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 66530317 |
| Molecular Formula | C14H20ClN5O2S |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | COc1cc(Cl)c(CNCCCSc2nnnn2C)cc1OC |
| InChI | InChI=1S/C14H20ClN5O2S/c1-20-14(17-18-19-20)23-6-4-5-16-9-10-7-12(21-2)13(22-3)8-11(10)15/h7-8,16H,4-6,9H2,1-3H3 |
| InChIKey | HHABOVDXNBJJGR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|