C19H22ClN5O2S — CID 66530316
N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 66530316) has the molecular formula C19H22ClN5O2S and a molecular weight of 419.94 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 66530316 |
| Molecular Formula | C19H22ClN5O2S |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | COc1cc(Cl)c(CNCCCSc2nnnn2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22ClN5O2S/c1-26-17-11-14(16(20)12-18(17)27-2)13-21-9-6-10-28-19-22-23-24-25(19)15-7-4-3-5-8-15/h3-5,7-8,11-12,21H,6,9-10,13H2,1-2H3 |
| InChIKey | ADVRDATUUWCNNW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|