C26H27Cl2N5O2S — CID 66531992
N-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 66531992) has the molecular formula C26H27Cl2N5O2S and a molecular weight of 544.51 g/mol. Its IUPAC name is N-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 66531992 |
| Molecular Formula | C26H27Cl2N5O2S |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | N-[[2-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | CCOc1cc(CNCCCSc2nnnn2-c2ccccc2)c(Cl)cc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H27Cl2N5O2S/c1-2-34-24-15-20(23(28)16-25(24)35-18-19-8-6-9-21(27)14-19)17-29-12-7-13-36-26-30-31-32-33(26)22-10-4-3-5-11-22/h3-6,8-11,14-16,29H,2,7,12-13,17-18H2,1H3 |
| InChIKey | LFGHRPDURDLMOK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|