C24H24Cl3N5OS — CID 17333564
N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 17333564) has the molecular formula C24H24Cl3N5OS and a molecular weight of 536.92 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17333564 |
| Molecular Formula | C24H24Cl3N5OS |
| Molecular Weight | 536.92 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(COc2ccccc2CNCCCSc2nnnn2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C24H23Cl2N5OS.ClH/c25-20-12-11-19(22(26)15-20)17-32-23-10-5-4-7-18(23)16-27-13-6-14-33-24-28-29-30-31(24)21-8-2-1-3-9-21;/h1-5,7-12,15,27H,6,13-14,16-17H2;1H |
| InChIKey | AXRGYMRAXGSXCB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|