C23H22Cl3N5OS — CID 17333224
N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17333224) has the molecular formula C23H22Cl3N5OS and a molecular weight of 522.89 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17333224 |
| Molecular Formula | C23H22Cl3N5OS |
| Molecular Weight | 522.89 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(COc2ccc(CNCCSc3nnnn3-c3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2N5OS.ClH/c24-19-9-8-18(22(25)14-19)16-31-21-10-6-17(7-11-21)15-26-12-13-32-23-27-28-29-30(23)20-4-2-1-3-5-20;/h1-11,14,26H,12-13,15-16H2;1H |
| InChIKey | QNWDVULDKIBTQE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.89 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|