C25H22Cl2N6S — CID 17158619
N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 17158619) has the molecular formula C25H22Cl2N6S and a molecular weight of 509.47 g/mol. Its IUPAC name is N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 17158619 |
| Molecular Formula | C25H22Cl2N6S |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | N-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Clc1ccc(Cn2cc(CNCCSc3nnnn3-c3ccccc3)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C25H22Cl2N6S/c26-20-11-10-18(23(27)14-20)16-32-17-19(22-8-4-5-9-24(22)32)15-28-12-13-34-25-29-30-31-33(25)21-6-2-1-3-7-21/h1-11,14,17,28H,12-13,15-16H2 |
| InChIKey | YOQKRNMCVFDRNB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|