C18H20Cl3N5OS — CID 17333312
N-[(3,5-dichloro-2-ethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17333312) has the molecular formula C18H20Cl3N5OS and a molecular weight of 460.82 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-ethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(3,5-dichloro-2-ethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17333312 |
| Molecular Formula | C18H20Cl3N5OS |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | N-[(3,5-dichloro-2-ethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | CCOc1c(Cl)cc(Cl)cc1CNCCSc1nnnn1-c1ccccc1.Cl |
| InChI | InChI=1S/C18H19Cl2N5OS.ClH/c1-2-26-17-13(10-14(19)11-16(17)20)12-21-8-9-27-18-22-23-24-25(18)15-6-4-3-5-7-15;/h3-7,10-11,21H,2,8-9,12H2,1H3;1H |
| InChIKey | WMWJMKGRBOSTLU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|