C25H25Cl2N5OS — CID 35698041
N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 35698041) has the molecular formula C25H25Cl2N5OS and a molecular weight of 514.48 g/mol. Its IUPAC name is N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 35698041 |
| Molecular Formula | C25H25Cl2N5OS |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | N-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Cc1ccc(COc2c(Cl)cc(Cl)cc2CNCCCSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25Cl2N5OS/c1-18-8-10-19(11-9-18)17-33-24-20(14-21(26)15-23(24)27)16-28-12-5-13-34-25-29-30-31-32(25)22-6-3-2-4-7-22/h2-4,6-11,14-15,28H,5,12-13,16-17H2,1H3 |
| InChIKey | PTLPPOZWOCHNNO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|