C26H28ClN5O2S — CID 17212768
N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 17212768) has the molecular formula C26H28ClN5O2S and a molecular weight of 510.06 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 17212768 |
| Molecular Formula | C26H28ClN5O2S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-[[2-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | CCOc1cccc(CNCCCSc2nnnn2-c2ccccc2)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28ClN5O2S/c1-2-33-24-11-6-8-21(25(24)34-19-20-12-14-22(27)15-13-20)18-28-16-7-17-35-26-29-30-31-32(26)23-9-4-3-5-10-23/h3-6,8-15,28H,2,7,16-19H2,1H3 |
| InChIKey | HGOVBJLDEZNMMT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|