C24H24ClN5OS — CID 4725023
N-[[2-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 4725023) has the molecular formula C24H24ClN5OS and a molecular weight of 466.01 g/mol. Its IUPAC name is N-[[2-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[2-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 4725023 |
| Molecular Formula | C24H24ClN5OS |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[[2-[(4-chlorophenyl)methoxy]phenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Clc1ccc(COc2ccccc2CNCCCSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24ClN5OS/c25-21-13-11-19(12-14-21)18-31-23-10-5-4-7-20(23)17-26-15-6-16-32-24-27-28-29-30(24)22-8-2-1-3-9-22/h1-5,7-14,26H,6,15-18H2 |
| InChIKey | HIZHHJLELOSDAB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|