C24H23BrClN5O2S — CID 66534474
N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 66534474) has the molecular formula C24H23BrClN5O2S and a molecular weight of 560.91 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 66534474 |
| Molecular Formula | C24H23BrClN5O2S |
| Molecular Weight | 560.91 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | COc1cc(CNCCSc2nnnn2-c2ccccc2)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23BrClN5O2S/c1-32-22-13-18(21(25)14-23(22)33-16-17-7-9-19(26)10-8-17)15-27-11-12-34-24-28-29-30-31(24)20-5-3-2-4-6-20/h2-10,13-14,27H,11-12,15-16H2,1H3 |
| InChIKey | WOKNHONPAJWIED-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.91 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|