C19H21BrFN5O2S — CID 66534161
N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine (PubChem CID 66534161) has the molecular formula C19H21BrFN5O2S and a molecular weight of 482.38 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 66534161 |
| Molecular Formula | C19H21BrFN5O2S |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
| SMILES | COc1cc(CNCCSc2nnnn2C)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21BrFN5O2S/c1-26-19(23-24-25-26)29-8-7-22-11-14-9-17(27-2)18(10-16(14)20)28-12-13-3-5-15(21)6-4-13/h3-6,9-10,22H,7-8,11-12H2,1-2H3 |
| InChIKey | GPUJRUOGAIMNFX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|