C20H23BrFN5O2S — CID 66532694
N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine (PubChem CID 66532694) has the molecular formula C20H23BrFN5O2S and a molecular weight of 496.41 g/mol. Its IUPAC name is N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 66532694 |
| Molecular Formula | C20H23BrFN5O2S |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine |
| SMILES | CCOc1cc(CNCCSc2nnnn2C)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H23BrFN5O2S/c1-3-28-18-10-15(12-23-8-9-30-20-24-25-26-27(20)2)17(21)11-19(18)29-13-14-4-6-16(22)7-5-14/h4-7,10-11,23H,3,8-9,12-13H2,1-2H3 |
| InChIKey | OFSVHISCORFUEK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|