C19H21BrFN5O2 — CID 66542061
N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-ethyltetrazol-5-amine (PubChem CID 66542061) has the molecular formula C19H21BrFN5O2 and a molecular weight of 450.31 g/mol. Its IUPAC name is N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-ethyltetrazol-5-amine.
| Compound Name | N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-ethyltetrazol-5-amine |
|---|---|
| PubChem CID | 66542061 |
| Molecular Formula | C19H21BrFN5O2 |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-ethyltetrazol-5-amine |
| SMILES | CCOc1cc(CNc2nnnn2CC)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21BrFN5O2/c1-3-26-19(23-24-25-26)22-11-14-9-17(27-4-2)18(10-16(14)20)28-12-13-5-7-15(21)8-6-13/h5-10H,3-4,11-12H2,1-2H3,(H,22,23,25) |
| InChIKey | KJMPJPKOVSQHEE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |