C12H16BrN5O2 — CID 66543215
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyltetrazol-5-amine (PubChem CID 66543215) has the molecular formula C12H16BrN5O2 and a molecular weight of 342.20 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyltetrazol-5-amine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyltetrazol-5-amine |
|---|---|
| PubChem CID | 66543215 |
| Molecular Formula | C12H16BrN5O2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyltetrazol-5-amine |
| SMILES | CCn1nnnc1NCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C12H16BrN5O2/c1-4-18-12(15-16-17-18)14-7-8-5-10(19-2)11(20-3)6-9(8)13/h5-6H,4,7H2,1-3H3,(H,14,15,17) |
| InChIKey | YDZRRELPJSARGA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |