C13H18BrN5O2 — CID 66542807
N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-methyltetrazol-5-amine (PubChem CID 66542807) has the molecular formula C13H18BrN5O2 and a molecular weight of 356.22 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 66542807 |
| Molecular Formula | C13H18BrN5O2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-[(2-bromo-5-methoxy-4-propoxyphenyl)methyl]-1-methyltetrazol-5-amine |
| SMILES | CCCOc1cc(Br)c(CNc2nnnn2C)cc1OC |
| InChI | InChI=1S/C13H18BrN5O2/c1-4-5-21-12-7-10(14)9(6-11(12)20-3)8-15-13-16-17-18-19(13)2/h6-7H,4-5,8H2,1-3H3,(H,15,16,18) |
| InChIKey | QOSBPZIUWVEGNR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |