C18H19BrFN5O2 — CID 66545060
N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-ethyltetrazol-5-amine (PubChem CID 66545060) has the molecular formula C18H19BrFN5O2 and a molecular weight of 436.29 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-ethyltetrazol-5-amine.
| Compound Name | N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-ethyltetrazol-5-amine |
|---|---|
| PubChem CID | 66545060 |
| Molecular Formula | C18H19BrFN5O2 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-ethyltetrazol-5-amine |
| SMILES | CCn1nnnc1NCc1cc(OC)c(OCc2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C18H19BrFN5O2/c1-3-25-18(22-23-24-25)21-10-13-8-16(26-2)17(9-15(13)19)27-11-12-4-6-14(20)7-5-12/h4-9H,3,10-11H2,1-2H3,(H,21,22,24) |
| InChIKey | JZNZSCJGCFKZIP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |