C22H28BrN5O2 — CID 66542108
N-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-1-butyltetrazol-5-amine (PubChem CID 66542108) has the molecular formula C22H28BrN5O2 and a molecular weight of 474.40 g/mol. Its IUPAC name is N-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-1-butyltetrazol-5-amine.
| Compound Name | N-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-1-butyltetrazol-5-amine |
|---|---|
| PubChem CID | 66542108 |
| Molecular Formula | C22H28BrN5O2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[[2-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-1-butyltetrazol-5-amine |
| SMILES | CCCCn1nnnc1NCc1cc(OCC)c(OCc2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C22H28BrN5O2/c1-4-6-11-28-22(25-26-27-28)24-14-18-12-20(29-5-2)21(13-19(18)23)30-15-17-9-7-16(3)8-10-17/h7-10,12-13H,4-6,11,14-15H2,1-3H3,(H,24,25,27) |
| InChIKey | NMNCJXOFEWHBEP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |