C21H25BrClN5O2 — CID 4725699
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-butyltetrazol-5-amine (PubChem CID 4725699) has the molecular formula C21H25BrClN5O2 and a molecular weight of 494.82 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-butyltetrazol-5-amine.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-butyltetrazol-5-amine |
|---|---|
| PubChem CID | 4725699 |
| Molecular Formula | C21H25BrClN5O2 |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-butyltetrazol-5-amine |
| SMILES | CCCCn1nnnc1NCc1cc(Br)c(OCc2ccc(Cl)cc2)c(OCC)c1 |
| InChI | InChI=1S/C21H25BrClN5O2/c1-3-5-10-28-21(25-26-27-28)24-13-16-11-18(22)20(19(12-16)29-4-2)30-14-15-6-8-17(23)9-7-15/h6-9,11-12H,3-5,10,13-14H2,1-2H3,(H,24,25,27) |
| InChIKey | OWAIQHYSJWOMPY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |