C22H28ClN5O2 — CID 66540970
1-butyl-N-[[2-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]tetrazol-5-amine (PubChem CID 66540970) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 1-butyl-N-[[2-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]tetrazol-5-amine.
| Compound Name | 1-butyl-N-[[2-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 66540970 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-butyl-N-[[2-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]tetrazol-5-amine |
| SMILES | CCCCn1nnnc1NCc1cc(OCC)c(OCc2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C22H28ClN5O2/c1-4-6-11-28-22(25-26-27-28)24-14-18-12-20(29-5-2)21(13-19(18)23)30-15-17-9-7-16(3)8-10-17/h7-10,12-13H,4-6,11,14-15H2,1-3H3,(H,24,25,27) |
| InChIKey | IALZMDDFTXBTHJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |