C15H20ClN5O2 — CID 66541765
N-[(2-chloro-4,5-diethoxyphenyl)methyl]-1-prop-2-enyltetrazol-5-amine (PubChem CID 66541765) has the molecular formula C15H20ClN5O2 and a molecular weight of 337.81 g/mol. Its IUPAC name is N-[(2-chloro-4,5-diethoxyphenyl)methyl]-1-prop-2-enyltetrazol-5-amine.
| Compound Name | N-[(2-chloro-4,5-diethoxyphenyl)methyl]-1-prop-2-enyltetrazol-5-amine |
|---|---|
| PubChem CID | 66541765 |
| Molecular Formula | C15H20ClN5O2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[(2-chloro-4,5-diethoxyphenyl)methyl]-1-prop-2-enyltetrazol-5-amine |
| SMILES | C=CCn1nnnc1NCc1cc(OCC)c(OCC)cc1Cl |
| InChI | InChI=1S/C15H20ClN5O2/c1-4-7-21-15(18-19-20-21)17-10-11-8-13(22-5-2)14(23-6-3)9-12(11)16/h4,8-9H,1,5-7,10H2,2-3H3,(H,17,18,20) |
| InChIKey | CHKTZAOZHKOSPD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|