C20H21BrClN5O2 — CID 66541589
N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine (PubChem CID 66541589) has the molecular formula C20H21BrClN5O2 and a molecular weight of 478.78 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine.
| Compound Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
|---|---|
| PubChem CID | 66541589 |
| Molecular Formula | C20H21BrClN5O2 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
| SMILES | C=CCn1nnnc1NCc1cc(OCC)c(OCc2ccccc2Cl)cc1Br |
| InChI | InChI=1S/C20H21BrClN5O2/c1-3-9-27-20(24-25-26-27)23-12-15-10-18(28-4-2)19(11-16(15)21)29-13-14-7-5-6-8-17(14)22/h3,5-8,10-11H,1,4,9,12-13H2,2H3,(H,23,24,26) |
| InChIKey | MEENMPPJPWNWFN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|