C21H26ClN5O2 — CID 66540944
N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-1-propyltetrazol-5-amine (PubChem CID 66540944) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-1-propyltetrazol-5-amine.
| Compound Name | N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-1-propyltetrazol-5-amine |
|---|---|
| PubChem CID | 66540944 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[[2-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-1-propyltetrazol-5-amine |
| SMILES | CCCn1nnnc1NCc1cc(OCC)c(OCc2cccc(C)c2)cc1Cl |
| InChI | InChI=1S/C21H26ClN5O2/c1-4-9-27-21(24-25-26-27)23-13-17-11-19(28-5-2)20(12-18(17)22)29-14-16-8-6-7-15(3)10-16/h6-8,10-12H,4-5,9,13-14H2,1-3H3,(H,23,24,26) |
| InChIKey | NINLZJCZFJTRIX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |