C20H21BrFN5O2 — CID 4726531
N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine (PubChem CID 4726531) has the molecular formula C20H21BrFN5O2 and a molecular weight of 462.32 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
|---|---|
| PubChem CID | 4726531 |
| Molecular Formula | C20H21BrFN5O2 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
| SMILES | C=CCn1nnnc1NCc1cc(Br)c(OCc2ccc(F)cc2)c(OCC)c1 |
| InChI | InChI=1S/C20H21BrFN5O2/c1-3-9-27-20(24-25-26-27)23-12-15-10-17(21)19(18(11-15)28-4-2)29-13-14-5-7-16(22)8-6-14/h3,5-8,10-11H,1,4,9,12-13H2,2H3,(H,23,24,26) |
| InChIKey | KKPQFHJFRSENHA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|