C19H19Cl2N5O2 — CID 4726583
N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine (PubChem CID 4726583) has the molecular formula C19H19Cl2N5O2 and a molecular weight of 420.30 g/mol. Its IUPAC name is N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine.
| Compound Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
|---|---|
| PubChem CID | 4726583 |
| Molecular Formula | C19H19Cl2N5O2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
| SMILES | C=CCn1nnnc1NCc1cc(Cl)c(OCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H19Cl2N5O2/c1-3-8-26-19(23-24-25-26)22-11-14-9-16(21)18(17(10-14)27-2)28-12-13-4-6-15(20)7-5-13/h3-7,9-10H,1,8,11-12H2,2H3,(H,22,23,25) |
| InChIKey | NCMVGMAUFSRBCD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|