C14H18N6O3 — CID 4726459
2-[2-methoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]acetamide (PubChem CID 4726459) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4726459 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[2-methoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]acetamide |
| SMILES | C=CCn1nnnc1NCc1ccc(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C14H18N6O3/c1-3-6-20-14(17-18-19-20)16-8-10-4-5-11(12(7-10)22-2)23-9-13(15)21/h3-5,7H,1,6,8-9H2,2H3,(H2,15,21)(H,16,17,19) |
| InChIKey | FRQTTWUXHSYJTO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|