C15H21ClN6O3 — CID 4726595
2-[4-[[(1-butyltetrazol-5-yl)amino]methyl]-2-chloro-6-methoxyphenoxy]acetamide (PubChem CID 4726595) has the molecular formula C15H21ClN6O3 and a molecular weight of 368.83 g/mol. Its IUPAC name is 2-[4-[[(1-butyltetrazol-5-yl)amino]methyl]-2-chloro-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[[(1-butyltetrazol-5-yl)amino]methyl]-2-chloro-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 4726595 |
| Molecular Formula | C15H21ClN6O3 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[4-[[(1-butyltetrazol-5-yl)amino]methyl]-2-chloro-6-methoxyphenoxy]acetamide |
| SMILES | CCCCn1nnnc1NCc1cc(Cl)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C15H21ClN6O3/c1-3-4-5-22-15(19-20-21-22)18-8-10-6-11(16)14(12(7-10)24-2)25-9-13(17)23/h6-7H,3-5,8-9H2,1-2H3,(H2,17,23)(H,18,19,21) |
| InChIKey | GFHQKFCXFGFERC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |