C14H19ClN6O3 — CID 4727524
2-[2-chloro-6-ethoxy-4-[[(1-ethyltetrazol-5-yl)amino]methyl]phenoxy]acetamide (PubChem CID 4727524) has the molecular formula C14H19ClN6O3 and a molecular weight of 354.80 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[(1-ethyltetrazol-5-yl)amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[(1-ethyltetrazol-5-yl)amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4727524 |
| Molecular Formula | C14H19ClN6O3 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[(1-ethyltetrazol-5-yl)amino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNc2nnnn2CC)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C14H19ClN6O3/c1-3-21-14(18-19-20-21)17-7-9-5-10(15)13(24-8-12(16)22)11(6-9)23-4-2/h5-6H,3-4,7-8H2,1-2H3,(H2,16,22)(H,17,18,20) |
| InChIKey | IYEYRWITEMQCTM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |