2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid

C13H18ClNO4 — CID 102535900

IUPAC2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid
SMILESCCNCc1cc(Cl)c(OCC(=O)O)c(OCC)c1
InChIInChI=1S/C13H18ClNO4/c1-3-15-7-9-5-10(14)13(19-8-12(16)17)11(6-9)18-4-2/h5-6,15H,3-4,7-8H2,1-2H3,(H,16,17)
InChIKeyMLKWBLCTSQTIFC-UHFFFAOYSA-N
MW287.74 g/mol
LogP2.31
Rot. Bonds8

About 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid

2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid (PubChem CID 102535900) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid
PubChem CID102535900
Molecular FormulaC13H18ClNO4
Molecular Weight287.74 g/mol
Exact Mass287.09
IUPAC Name2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid
SMILESCCNCc1cc(Cl)c(OCC(=O)O)c(OCC)c1
InChIInChI=1S/C13H18ClNO4/c1-3-15-7-9-5-10(14)13(19-8-12(16)17)11(6-9)18-4-2/h5-6,15H,3-4,7-8H2,1-2H3,(H,16,17)
InChIKeyMLKWBLCTSQTIFC-UHFFFAOYSA-N
XLogP2.31
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.74
LogP ≤ 52.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid?
The IUPAC name of 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid (CID 102535900) is 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid?
The canonical SMILES for 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid is CCNCc1cc(Cl)c(OCC(=O)O)c(OCC)c1.
What is the InChIKey of 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid?
The InChIKey is MLKWBLCTSQTIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO4/c1-3-15-7-9-5-10(14)13(19-8-12(16)17)11(6-9)18-4-2/h5-6,15H,3-4,7-8H2,1-2H3,(H,16,17).
What are the key properties of 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid?
2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid has a molecular weight of 287.74 g/mol, XLogP of 2.31, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetic acid is sourced from PubChem (CID 102535900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).